C15H21NO5 — CID 104624433
tert-butyl 3-[2-(furan-2-yl)-2-oxoethyl]morpholine-4-carboxylate (PubChem CID 104624433) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is tert-butyl 3-[2-(furan-2-yl)-2-oxoethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-(furan-2-yl)-2-oxoethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 104624433 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | tert-butyl 3-[2-(furan-2-yl)-2-oxoethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1CC(=O)c1ccco1 |
| InChI | InChI=1S/C15H21NO5/c1-15(2,3)21-14(18)16-6-8-19-10-11(16)9-12(17)13-5-4-7-20-13/h4-5,7,11H,6,8-10H2,1-3H3 |
| InChIKey | GOWSEMNWDAZDAC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |