C16H15ClN2O4 — CID 75389849
2-[4-(5-chloropyridine-2-carbonyl)morpholin-3-yl]-1-(furan-2-yl)ethanone (PubChem CID 75389849) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is 2-[4-(5-chloropyridine-2-carbonyl)morpholin-3-yl]-1-(furan-2-yl)ethanone.
| Compound Name | 2-[4-(5-chloropyridine-2-carbonyl)morpholin-3-yl]-1-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 75389849 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-[4-(5-chloropyridine-2-carbonyl)morpholin-3-yl]-1-(furan-2-yl)ethanone |
| SMILES | O=C(CC1COCCN1C(=O)c1ccc(Cl)cn1)c1ccco1 |
| InChI | InChI=1S/C16H15ClN2O4/c17-11-3-4-13(18-9-11)16(21)19-5-7-22-10-12(19)8-14(20)15-2-1-6-23-15/h1-4,6,9,12H,5,7-8,10H2 |
| InChIKey | VLTHWXAWTVNTLY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |