C13H16BrNO3 — CID 99586170
2-[(3R)-4-(2-bromoprop-2-enyl)morpholin-3-yl]-1-(furan-2-yl)ethanone (PubChem CID 99586170) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is 2-[(3R)-4-(2-bromoprop-2-enyl)morpholin-3-yl]-1-(furan-2-yl)ethanone.
| Compound Name | 2-[(3R)-4-(2-bromoprop-2-enyl)morpholin-3-yl]-1-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 99586170 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-[(3R)-4-(2-bromoprop-2-enyl)morpholin-3-yl]-1-(furan-2-yl)ethanone |
| SMILES | C=C(Br)CN1CCOC[C@H]1CC(=O)c1ccco1 |
| InChI | InChI=1S/C13H16BrNO3/c1-10(14)8-15-4-6-17-9-11(15)7-12(16)13-3-2-5-18-13/h2-3,5,11H,1,4,6-9H2/t11-/m1/s1 |
| InChIKey | WQZNLQPKIYGLLQ-LLVKDONJSA-N |
| XLogP | 2.46 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |