C16H17NO4S — CID 97244002
1-(furan-2-yl)-2-[(3S)-4-(4-methylthiophene-3-carbonyl)morpholin-3-yl]ethanone (PubChem CID 97244002) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[(3S)-4-(4-methylthiophene-3-carbonyl)morpholin-3-yl]ethanone.
| Compound Name | 1-(furan-2-yl)-2-[(3S)-4-(4-methylthiophene-3-carbonyl)morpholin-3-yl]ethanone |
|---|---|
| PubChem CID | 97244002 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 1-(furan-2-yl)-2-[(3S)-4-(4-methylthiophene-3-carbonyl)morpholin-3-yl]ethanone |
| SMILES | Cc1cscc1C(=O)N1CCOC[C@@H]1CC(=O)c1ccco1 |
| InChI | InChI=1S/C16H17NO4S/c1-11-9-22-10-13(11)16(19)17-4-6-20-8-12(17)7-14(18)15-3-2-5-21-15/h2-3,5,9-10,12H,4,6-8H2,1H3/t12-/m0/s1 |
| InChIKey | HCSDFYVIWPJLKX-LBPRGKRZSA-N |
| XLogP | 2.76 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |