C12H20ClNO5 — CID 165438860
tert-butyl 3-[2-(chloromethoxy)-2-oxoethyl]morpholine-4-carboxylate (PubChem CID 165438860) has the molecular formula C12H20ClNO5 and a molecular weight of 293.75 g/mol. Its IUPAC name is tert-butyl 3-[2-(chloromethoxy)-2-oxoethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-(chloromethoxy)-2-oxoethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 165438860 |
| Molecular Formula | C12H20ClNO5 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | tert-butyl 3-[2-(chloromethoxy)-2-oxoethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1CC(=O)OCCl |
| InChI | InChI=1S/C12H20ClNO5/c1-12(2,3)19-11(16)14-4-5-17-7-9(14)6-10(15)18-8-13/h9H,4-8H2,1-3H3 |
| InChIKey | SYJIOMNQEPIDNO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|