C12H22FNO4 — CID 134168093
tert-butyl (3S)-3-(1-fluoroethoxymethyl)morpholine-4-carboxylate (PubChem CID 134168093) has the molecular formula C12H22FNO4 and a molecular weight of 263.31 g/mol. Its IUPAC name is tert-butyl (3S)-3-(1-fluoroethoxymethyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl (3S)-3-(1-fluoroethoxymethyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 134168093 |
| Molecular Formula | C12H22FNO4 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | tert-butyl (3S)-3-(1-fluoroethoxymethyl)morpholine-4-carboxylate |
| SMILES | CC(F)OC[C@@H]1COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22FNO4/c1-9(13)17-8-10-7-16-6-5-14(10)11(15)18-12(2,3)4/h9-10H,5-8H2,1-4H3/t9?,10-/m0/s1 |
| InChIKey | CQLQXTJFFWGPAC-AXDSSHIGSA-N |
| XLogP | 1.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |