C15H32N4O6 — CID 159531809
tert-butyl (3R)-3-(aminooxymethyl)morpholine-4-carboxylate;O-[[(3R)-morpholin-3-yl]methyl]hydroxylamine (PubChem CID 159531809) has the molecular formula C15H32N4O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is tert-butyl (3R)-3-(aminooxymethyl)morpholine-4-carboxylate;O-[[(3R)-morpholin-3-yl]methyl]hydroxylamine.
| Compound Name | tert-butyl (3R)-3-(aminooxymethyl)morpholine-4-carboxylate;O-[[(3R)-morpholin-3-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 159531809 |
| Molecular Formula | C15H32N4O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | tert-butyl (3R)-3-(aminooxymethyl)morpholine-4-carboxylate;O-[[(3R)-morpholin-3-yl]methyl]hydroxylamine |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@@H]1CON.NOC[C@H]1COCCN1 |
| InChI | InChI=1S/C10H20N2O4.C5H12N2O2/c1-10(2,3)16-9(13)12-4-5-14-6-8(12)7-15-11;6-9-4-5-3-8-2-1-7-5/h8H,4-7,11H2,1-3H3;5,7H,1-4,6H2/t8-;5-/m11/s1 |
| InChIKey | MDCANVVFHFFCHT-AKUDJJMXSA-N |
| XLogP | -0.62 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|