C15H20BrNO5 — CID 104856606
tert-butyl 3-[2-(5-bromofuran-2-yl)-2-oxoethyl]morpholine-4-carboxylate (PubChem CID 104856606) has the molecular formula C15H20BrNO5 and a molecular weight of 374.23 g/mol. Its IUPAC name is tert-butyl 3-[2-(5-bromofuran-2-yl)-2-oxoethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-(5-bromofuran-2-yl)-2-oxoethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 104856606 |
| Molecular Formula | C15H20BrNO5 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | tert-butyl 3-[2-(5-bromofuran-2-yl)-2-oxoethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1CC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H20BrNO5/c1-15(2,3)22-14(19)17-6-7-20-9-10(17)8-11(18)12-4-5-13(16)21-12/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | NLGYLPZXHJHNNP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |