C15H23BrN2O3S — CID 107249698
tert-butyl 3-[[(5-bromothiophen-3-yl)methylamino]methyl]morpholine-4-carboxylate (PubChem CID 107249698) has the molecular formula C15H23BrN2O3S and a molecular weight of 391.33 g/mol. Its IUPAC name is tert-butyl 3-[[(5-bromothiophen-3-yl)methylamino]methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[[(5-bromothiophen-3-yl)methylamino]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 107249698 |
| Molecular Formula | C15H23BrN2O3S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | tert-butyl 3-[[(5-bromothiophen-3-yl)methylamino]methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1CNCc1csc(Br)c1 |
| InChI | InChI=1S/C15H23BrN2O3S/c1-15(2,3)21-14(19)18-4-5-20-9-12(18)8-17-7-11-6-13(16)22-10-11/h6,10,12,17H,4-5,7-9H2,1-3H3 |
| InChIKey | WNFZQOWXWUUPQN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |