C16H25N3O3 — CID 107249690
tert-butyl 3-[(pyridin-2-ylmethylamino)methyl]morpholine-4-carboxylate (PubChem CID 107249690) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl 3-[(pyridin-2-ylmethylamino)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[(pyridin-2-ylmethylamino)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 107249690 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl 3-[(pyridin-2-ylmethylamino)methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1CNCc1ccccn1 |
| InChI | InChI=1S/C16H25N3O3/c1-16(2,3)22-15(20)19-8-9-21-12-14(19)11-17-10-13-6-4-5-7-18-13/h4-7,14,17H,8-12H2,1-3H3 |
| InChIKey | PFDVGJJSBGYTJB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |