C23H25NO4 — CID 97320578
1-(4-methylphenyl)-4-[(3S)-3-phenacylmorpholin-4-yl]butane-1,4-dione (PubChem CID 97320578) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4-[(3S)-3-phenacylmorpholin-4-yl]butane-1,4-dione.
| Compound Name | 1-(4-methylphenyl)-4-[(3S)-3-phenacylmorpholin-4-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 97320578 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-(4-methylphenyl)-4-[(3S)-3-phenacylmorpholin-4-yl]butane-1,4-dione |
| SMILES | Cc1ccc(C(=O)CCC(=O)N2CCOC[C@@H]2CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-17-7-9-19(10-8-17)21(25)11-12-23(27)24-13-14-28-16-20(24)15-22(26)18-5-3-2-4-6-18/h2-10,20H,11-16H2,1H3/t20-/m0/s1 |
| InChIKey | DBOQUPZRBVTZQC-FQEVSTJZSA-N |
| XLogP | 3.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |