C18H25NO2 — CID 110295013
1-(2-ethylpiperidin-1-yl)-4-(4-methylphenyl)butane-1,4-dione (PubChem CID 110295013) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-4-(4-methylphenyl)butane-1,4-dione.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-4-(4-methylphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 110295013 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-4-(4-methylphenyl)butane-1,4-dione |
| SMILES | CCC1CCCCN1C(=O)CCC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO2/c1-3-16-6-4-5-13-19(16)18(21)12-11-17(20)15-9-7-14(2)8-10-15/h7-10,16H,3-6,11-13H2,1-2H3 |
| InChIKey | FIMYRLBOBYZSIN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |