C16H20ClNO2 — CID 110619138
1-(4-chlorophenyl)-4-(2-ethylpyrrolidin-1-yl)butane-1,4-dione (PubChem CID 110619138) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-(2-ethylpyrrolidin-1-yl)butane-1,4-dione.
| Compound Name | 1-(4-chlorophenyl)-4-(2-ethylpyrrolidin-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 110619138 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(4-chlorophenyl)-4-(2-ethylpyrrolidin-1-yl)butane-1,4-dione |
| SMILES | CCC1CCCN1C(=O)CCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO2/c1-2-14-4-3-11-18(14)16(20)10-9-15(19)12-5-7-13(17)8-6-12/h5-8,14H,2-4,9-11H2,1H3 |
| InChIKey | KLFLTXNAXXBOGX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |