C18H21N3O3 — CID 97320552
(2S)-1-[(3R)-3-phenacylmorpholin-4-yl]-2-pyrazol-1-ylpropan-1-one (PubChem CID 97320552) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2S)-1-[(3R)-3-phenacylmorpholin-4-yl]-2-pyrazol-1-ylpropan-1-one.
| Compound Name | (2S)-1-[(3R)-3-phenacylmorpholin-4-yl]-2-pyrazol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 97320552 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (2S)-1-[(3R)-3-phenacylmorpholin-4-yl]-2-pyrazol-1-ylpropan-1-one |
| SMILES | C[C@@H](C(=O)N1CCOC[C@H]1CC(=O)c1ccccc1)n1cccn1 |
| InChI | InChI=1S/C18H21N3O3/c1-14(21-9-5-8-19-21)18(23)20-10-11-24-13-16(20)12-17(22)15-6-3-2-4-7-15/h2-9,14,16H,10-13H2,1H3/t14-,16+/m0/s1 |
| InChIKey | LBBGHVPGVFQCSL-GOEBONIOSA-N |
| XLogP | 1.94 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |