2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid

C21H23NO4 — CID 129469743

IUPAC2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid
SMILESO=C(O)C[C@@H]1COCCN1C(=O)CC(c1ccccc1)c1ccccc1
InChIInChI=1S/C21H23NO4/c23-20(22-11-12-26-15-18(22)13-21(24)25)14-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18-19H,11-15H2,(H,24,25)/t18-/m1/s1
InChIKeyFZQFTRCSVJVVMV-GOSISDBHSA-N
MW353.42 g/mol
LogP2.91
Rot. Bonds6

About 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid

2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid (PubChem CID 129469743) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid.

Molecular Properties

Compound Name2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid
PubChem CID129469743
Molecular FormulaC21H23NO4
Molecular Weight353.42 g/mol
Exact Mass353.16
IUPAC Name2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid
SMILESO=C(O)C[C@@H]1COCCN1C(=O)CC(c1ccccc1)c1ccccc1
InChIInChI=1S/C21H23NO4/c23-20(22-11-12-26-15-18(22)13-21(24)25)14-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18-19H,11-15H2,(H,24,25)/t18-/m1/s1
InChIKeyFZQFTRCSVJVVMV-GOSISDBHSA-N
XLogP2.91
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.42
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid?
The IUPAC name of 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid (CID 129469743) is 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid.
What is the SMILES notation for 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid?
The canonical SMILES for 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid is O=C(O)C[C@@H]1COCCN1C(=O)CC(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid?
The InChIKey is FZQFTRCSVJVVMV-GOSISDBHSA-N. The full InChI is InChI=1S/C21H23NO4/c23-20(22-11-12-26-15-18(22)13-21(24)25)14-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18-19H,11-15H2,(H,24,25)/t18-/m1/s1.
What are the key properties of 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid?
2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid has a molecular weight of 353.42 g/mol, XLogP of 2.91, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-4-(3,3-diphenylpropanoyl)morpholin-3-yl]acetic acid is sourced from PubChem (CID 129469743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).