C15H21N3O4 — CID 118796116
2-[4-[2-[methyl(pyridin-2-ylmethyl)amino]acetyl]morpholin-3-yl]acetic acid (PubChem CID 118796116) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[4-[2-[methyl(pyridin-2-ylmethyl)amino]acetyl]morpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[2-[methyl(pyridin-2-ylmethyl)amino]acetyl]morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 118796116 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[4-[2-[methyl(pyridin-2-ylmethyl)amino]acetyl]morpholin-3-yl]acetic acid |
| SMILES | CN(CC(=O)N1CCOCC1CC(=O)O)Cc1ccccn1 |
| InChI | InChI=1S/C15H21N3O4/c1-17(9-12-4-2-3-5-16-12)10-14(19)18-6-7-22-11-13(18)8-15(20)21/h2-5,13H,6-11H2,1H3,(H,20,21) |
| InChIKey | NVABWBVDBGOLRQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |