C19H22N2O4 — CID 95718552
2-[(3R)-4-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]morpholin-3-yl]acetic acid (PubChem CID 95718552) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[(3R)-4-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]morpholin-3-yl]acetic acid.
| Compound Name | 2-[(3R)-4-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 95718552 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-[(3R)-4-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]morpholin-3-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1COCCN1Cc1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C19H22N2O4/c22-19(23)11-17-14-24-10-9-21(17)12-15-4-6-18(7-5-15)25-13-16-3-1-2-8-20-16/h1-8,17H,9-14H2,(H,22,23)/t17-/m1/s1 |
| InChIKey | LGJMDZLQQOZMSV-QGZVFWFLSA-N |
| XLogP | 2.34 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |