C20H21NO3 — CID 56913375
2-[4-(9H-fluoren-2-ylmethyl)morpholin-3-yl]acetic acid (PubChem CID 56913375) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[4-(9H-fluoren-2-ylmethyl)morpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(9H-fluoren-2-ylmethyl)morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 56913375 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[4-(9H-fluoren-2-ylmethyl)morpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1COCCN1Cc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C20H21NO3/c22-20(23)11-17-13-24-8-7-21(17)12-14-5-6-19-16(9-14)10-15-3-1-2-4-18(15)19/h1-6,9,17H,7-8,10-13H2,(H,22,23) |
| InChIKey | DIDALCKOZUAAQI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |