C18H26N2O3 — CID 136567968
1-[3-(oxan-4-ylmethyl)morpholin-4-yl]-3-pyridin-2-ylpropan-1-one (PubChem CID 136567968) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[3-(oxan-4-ylmethyl)morpholin-4-yl]-3-pyridin-2-ylpropan-1-one.
| Compound Name | 1-[3-(oxan-4-ylmethyl)morpholin-4-yl]-3-pyridin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 136567968 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-[3-(oxan-4-ylmethyl)morpholin-4-yl]-3-pyridin-2-ylpropan-1-one |
| SMILES | O=C(CCc1ccccn1)N1CCOCC1CC1CCOCC1 |
| InChI | InChI=1S/C18H26N2O3/c21-18(5-4-16-3-1-2-8-19-16)20-9-12-23-14-17(20)13-15-6-10-22-11-7-15/h1-3,8,15,17H,4-7,9-14H2 |
| InChIKey | VBLSXNLOHYYVHU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |