C18H27N3O4 — CID 136568232
N-[(2-methoxy-4-pyridinyl)methyl]-3-(oxan-4-ylmethyl)morpholine-4-carboxamide (PubChem CID 136568232) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[(2-methoxy-4-pyridinyl)methyl]-3-(oxan-4-ylmethyl)morpholine-4-carboxamide.
| Compound Name | N-[(2-methoxy-4-pyridinyl)methyl]-3-(oxan-4-ylmethyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 136568232 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N-[(2-methoxy-4-pyridinyl)methyl]-3-(oxan-4-ylmethyl)morpholine-4-carboxamide |
| SMILES | COc1cc(CNC(=O)N2CCOCC2CC2CCOCC2)ccn1 |
| InChI | InChI=1S/C18H27N3O4/c1-23-17-11-15(2-5-19-17)12-20-18(22)21-6-9-25-13-16(21)10-14-3-7-24-8-4-14/h2,5,11,14,16H,3-4,6-10,12-13H2,1H3,(H,20,22) |
| InChIKey | KIUMMDYRBRUDSW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |