C17H26N4O2 — CID 47048297
N-[(2-methoxy-4-pyridinyl)methyl]-3-pyrrolidin-1-ylpiperidine-1-carboxamide (PubChem CID 47048297) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[(2-methoxy-4-pyridinyl)methyl]-3-pyrrolidin-1-ylpiperidine-1-carboxamide.
| Compound Name | N-[(2-methoxy-4-pyridinyl)methyl]-3-pyrrolidin-1-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 47048297 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-[(2-methoxy-4-pyridinyl)methyl]-3-pyrrolidin-1-ylpiperidine-1-carboxamide |
| SMILES | COc1cc(CNC(=O)N2CCCC(N3CCCC3)C2)ccn1 |
| InChI | InChI=1S/C17H26N4O2/c1-23-16-11-14(6-7-18-16)12-19-17(22)21-10-4-5-15(13-21)20-8-2-3-9-20/h6-7,11,15H,2-5,8-10,12-13H2,1H3,(H,19,22) |
| InChIKey | NZCJSUUSLHRFBT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |