C15H22N2O2 — CID 116636366
1-[2-(hydroxymethyl)azepan-1-yl]-3-pyridin-2-ylpropan-1-one (PubChem CID 116636366) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)azepan-1-yl]-3-pyridin-2-ylpropan-1-one.
| Compound Name | 1-[2-(hydroxymethyl)azepan-1-yl]-3-pyridin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 116636366 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-[2-(hydroxymethyl)azepan-1-yl]-3-pyridin-2-ylpropan-1-one |
| SMILES | O=C(CCc1ccccn1)N1CCCCCC1CO |
| InChI | InChI=1S/C15H22N2O2/c18-12-14-7-2-1-5-11-17(14)15(19)9-8-13-6-3-4-10-16-13/h3-4,6,10,14,18H,1-2,5,7-9,11-12H2 |
| InChIKey | ZGZSYUARPVJMAP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |