C19H28N2O4 — CID 136567969
1-[4-[3-(oxan-4-ylmethyl)morpholin-4-yl]-4-oxobutyl]pyridin-2-one (PubChem CID 136567969) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-[4-[3-(oxan-4-ylmethyl)morpholin-4-yl]-4-oxobutyl]pyridin-2-one.
| Compound Name | 1-[4-[3-(oxan-4-ylmethyl)morpholin-4-yl]-4-oxobutyl]pyridin-2-one |
|---|---|
| PubChem CID | 136567969 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[4-[3-(oxan-4-ylmethyl)morpholin-4-yl]-4-oxobutyl]pyridin-2-one |
| SMILES | O=C(CCCn1ccccc1=O)N1CCOCC1CC1CCOCC1 |
| InChI | InChI=1S/C19H28N2O4/c22-18-4-1-2-8-20(18)9-3-5-19(23)21-10-13-25-15-17(21)14-16-6-11-24-12-7-16/h1-2,4,8,16-17H,3,5-7,9-15H2 |
| InChIKey | KHCWENCZGKQEGD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |