C22H27N3O2 — CID 70723407
1-(4-acetyl-4-phenylpiperidin-1-yl)-2-[methyl(pyridin-2-ylmethyl)amino]ethanone (PubChem CID 70723407) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-(4-acetyl-4-phenylpiperidin-1-yl)-2-[methyl(pyridin-2-ylmethyl)amino]ethanone.
| Compound Name | 1-(4-acetyl-4-phenylpiperidin-1-yl)-2-[methyl(pyridin-2-ylmethyl)amino]ethanone |
|---|---|
| PubChem CID | 70723407 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-(4-acetyl-4-phenylpiperidin-1-yl)-2-[methyl(pyridin-2-ylmethyl)amino]ethanone |
| SMILES | CC(=O)C1(c2ccccc2)CCN(C(=O)CN(C)Cc2ccccn2)CC1 |
| InChI | InChI=1S/C22H27N3O2/c1-18(26)22(19-8-4-3-5-9-19)11-14-25(15-12-22)21(27)17-24(2)16-20-10-6-7-13-23-20/h3-10,13H,11-12,14-17H2,1-2H3 |
| InChIKey | ZKZDLADGWRKWJD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |