C20H22N2O3 — CID 15055617
[4-phenyl-1-(2-pyridin-2-ylacetyl)piperidin-4-yl] acetate (PubChem CID 15055617) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is [4-phenyl-1-(2-pyridin-2-ylacetyl)piperidin-4-yl] acetate.
| Compound Name | [4-phenyl-1-(2-pyridin-2-ylacetyl)piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 15055617 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [4-phenyl-1-(2-pyridin-2-ylacetyl)piperidin-4-yl] acetate |
| SMILES | CC(=O)OC1(c2ccccc2)CCN(C(=O)Cc2ccccn2)CC1 |
| InChI | InChI=1S/C20H22N2O3/c1-16(23)25-20(17-7-3-2-4-8-17)10-13-22(14-11-20)19(24)15-18-9-5-6-12-21-18/h2-9,12H,10-11,13-15H2,1H3 |
| InChIKey | XSLRCBMGAJPOTH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |