C13H17N3O2 — CID 110696934
1-(2-pyridin-2-ylacetyl)piperidine-4-carboxamide (PubChem CID 110696934) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-(2-pyridin-2-ylacetyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-pyridin-2-ylacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110696934 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-(2-pyridin-2-ylacetyl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)Cc2ccccn2)CC1 |
| InChI | InChI=1S/C13H17N3O2/c14-13(18)10-4-7-16(8-5-10)12(17)9-11-3-1-2-6-15-11/h1-3,6,10H,4-5,7-9H2,(H2,14,18) |
| InChIKey | XFYYFCLTXIXYDX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |