C11H14N2O3 — CID 106671158
1-(3,4-dihydroxypyrrolidin-1-yl)-2-pyridin-2-ylethanone (PubChem CID 106671158) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-(3,4-dihydroxypyrrolidin-1-yl)-2-pyridin-2-ylethanone.
| Compound Name | 1-(3,4-dihydroxypyrrolidin-1-yl)-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 106671158 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-(3,4-dihydroxypyrrolidin-1-yl)-2-pyridin-2-ylethanone |
| SMILES | O=C(Cc1ccccn1)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C11H14N2O3/c14-9-6-13(7-10(9)15)11(16)5-8-3-1-2-4-12-8/h1-4,9-10,14-15H,5-7H2 |
| InChIKey | PVTLFFHTKULNIF-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |