C23H16N2O2S — CID 10110569
[3-(4-amino-2-phenyl-1,3-thiazole-5-carbonyl)phenyl]-phenylmethanone (PubChem CID 10110569) has the molecular formula C23H16N2O2S and a molecular weight of 384.46 g/mol. Its IUPAC name is [3-(4-amino-2-phenyl-1,3-thiazole-5-carbonyl)phenyl]-phenylmethanone.
| Compound Name | [3-(4-amino-2-phenyl-1,3-thiazole-5-carbonyl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 10110569 |
| Molecular Formula | C23H16N2O2S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [3-(4-amino-2-phenyl-1,3-thiazole-5-carbonyl)phenyl]-phenylmethanone |
| SMILES | Nc1nc(-c2ccccc2)sc1C(=O)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H16N2O2S/c24-22-21(28-23(25-22)16-10-5-2-6-11-16)20(27)18-13-7-12-17(14-18)19(26)15-8-3-1-4-9-15/h1-14H,24H2 |
| InChIKey | HRACEBWDUKOGMP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |