C9H8ClN3S — CID 75446200
N-benzyl-5-chloro-1,3,4-thiadiazol-2-amine (PubChem CID 75446200) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is N-benzyl-5-chloro-1,3,4-thiadiazol-2-amine.
| Compound Name | N-benzyl-5-chloro-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 75446200 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | N-benzyl-5-chloro-1,3,4-thiadiazol-2-amine |
| SMILES | Clc1nnc(NCc2ccccc2)s1 |
| InChI | InChI=1S/C9H8ClN3S/c10-8-12-13-9(14-8)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,13) |
| InChIKey | UZOSPKDAKAJRQN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |