C16H21N5OS — CID 75092258
4-amino-2-(benzylamino)-N-piperidin-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 75092258) has the molecular formula C16H21N5OS and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-amino-2-(benzylamino)-N-piperidin-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(benzylamino)-N-piperidin-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 75092258 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 4-amino-2-(benzylamino)-N-piperidin-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | Nc1nc(NCc2ccccc2)sc1C(=O)NC1CCCNC1 |
| InChI | InChI=1S/C16H21N5OS/c17-14-13(15(22)20-12-7-4-8-18-10-12)23-16(21-14)19-9-11-5-2-1-3-6-11/h1-3,5-6,12,18H,4,7-10,17H2,(H,19,21)(H,20,22) |
| InChIKey | ZPIYIOZQEFLCNU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |