C17H24N6OS — CID 75092259
4-amino-2-[4-(dimethylamino)anilino]-N-piperidin-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 75092259) has the molecular formula C17H24N6OS and a molecular weight of 360.49 g/mol. Its IUPAC name is 4-amino-2-[4-(dimethylamino)anilino]-N-piperidin-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-[4-(dimethylamino)anilino]-N-piperidin-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 75092259 |
| Molecular Formula | C17H24N6OS |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-amino-2-[4-(dimethylamino)anilino]-N-piperidin-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | CN(C)c1ccc(Nc2nc(N)c(C(=O)NC3CCCNC3)s2)cc1 |
| InChI | InChI=1S/C17H24N6OS/c1-23(2)13-7-5-11(6-8-13)21-17-22-15(18)14(25-17)16(24)20-12-4-3-9-19-10-12/h5-8,12,19H,3-4,9-10,18H2,1-2H3,(H,20,24)(H,21,22) |
| InChIKey | NNOGBJUNUASVPD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|