C14H12N2S — CID 617555
N-benzyl-1,3-benzothiazol-2-amine (PubChem CID 617555) has the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. Its IUPAC name is N-benzyl-1,3-benzothiazol-2-amine.
| Compound Name | N-benzyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 617555 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | N-benzyl-1,3-benzothiazol-2-amine |
| SMILES | c1ccc(CNc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C14H12N2S/c1-2-6-11(7-3-1)10-15-14-16-12-8-4-5-9-13(12)17-14/h1-9H,10H2,(H,15,16) |
| InChIKey | WCTMSMWBZPBBIF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |