C15H13ClN2S — CID 65028278
N-[[3-(chloromethyl)phenyl]methyl]-1,3-benzothiazol-2-amine (PubChem CID 65028278) has the molecular formula C15H13ClN2S and a molecular weight of 288.80 g/mol. Its IUPAC name is N-[[3-(chloromethyl)phenyl]methyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[[3-(chloromethyl)phenyl]methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 65028278 |
| Molecular Formula | C15H13ClN2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N-[[3-(chloromethyl)phenyl]methyl]-1,3-benzothiazol-2-amine |
| SMILES | ClCc1cccc(CNc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C15H13ClN2S/c16-9-11-4-3-5-12(8-11)10-17-15-18-13-6-1-2-7-14(13)19-15/h1-8H,9-10H2,(H,17,18) |
| InChIKey | MIWNSFXCLUJNAW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|