C18H17N3OS — CID 133312434
2-[3-[(1,3-benzothiazol-2-ylamino)methyl]phenoxy]butanenitrile (PubChem CID 133312434) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[3-[(1,3-benzothiazol-2-ylamino)methyl]phenoxy]butanenitrile.
| Compound Name | 2-[3-[(1,3-benzothiazol-2-ylamino)methyl]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 133312434 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[3-[(1,3-benzothiazol-2-ylamino)methyl]phenoxy]butanenitrile |
| SMILES | CCC(C#N)Oc1cccc(CNc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C18H17N3OS/c1-2-14(11-19)22-15-7-5-6-13(10-15)12-20-18-21-16-8-3-4-9-17(16)23-18/h3-10,14H,2,12H2,1H3,(H,20,21) |
| InChIKey | VIYWQHRGUBGBEA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |