C15H14N2OS — CID 7208982
N-benzyl-5-methoxy-1,3-benzothiazol-2-amine (PubChem CID 7208982) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is N-benzyl-5-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-benzyl-5-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 7208982 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-benzyl-5-methoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2sc(NCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C15H14N2OS/c1-18-12-7-8-14-13(9-12)17-15(19-14)16-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,16,17) |
| InChIKey | ZEIIQWUVDVGXOK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |