C11H10N2OS — CID 45077219
5-methoxy-N-prop-2-ynyl-1,3-benzothiazol-2-amine (PubChem CID 45077219) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 5-methoxy-N-prop-2-ynyl-1,3-benzothiazol-2-amine.
| Compound Name | 5-methoxy-N-prop-2-ynyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 45077219 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 5-methoxy-N-prop-2-ynyl-1,3-benzothiazol-2-amine |
| SMILES | C#CCNc1nc2cc(OC)ccc2s1 |
| InChI | InChI=1S/C11H10N2OS/c1-3-6-12-11-13-9-7-8(14-2)4-5-10(9)15-11/h1,4-5,7H,6H2,2H3,(H,12,13) |
| InChIKey | QPGOKVQDWKVTAJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|