C11H15NOS — CID 142881099
ethane;5-methoxy-2-methyl-1,3-benzothiazole (PubChem CID 142881099) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is ethane;5-methoxy-2-methyl-1,3-benzothiazole.
| Compound Name | ethane;5-methoxy-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 142881099 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | ethane;5-methoxy-2-methyl-1,3-benzothiazole |
| SMILES | CC.COc1ccc2sc(C)nc2c1 |
| InChI | InChI=1S/C9H9NOS.C2H6/c1-6-10-8-5-7(11-2)3-4-9(8)12-6;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | WICHWQPDTQLJSY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |