C9H7NO3S — CID 45077357
5-methoxy-1,3-benzothiazole-2-carboxylic acid (PubChem CID 45077357) has the molecular formula C9H7NO3S and a molecular weight of 209.23 g/mol. Its IUPAC name is 5-methoxy-1,3-benzothiazole-2-carboxylic acid.
| Compound Name | 5-methoxy-1,3-benzothiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 45077357 |
| Molecular Formula | C9H7NO3S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 5-methoxy-1,3-benzothiazole-2-carboxylic acid |
| SMILES | COc1ccc2sc(C(=O)O)nc2c1 |
| InChI | InChI=1S/C9H7NO3S/c1-13-5-2-3-7-6(4-5)10-8(14-7)9(11)12/h2-4H,1H3,(H,11,12) |
| InChIKey | HZCUQHHEHCKENU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |