C13H14N2O3S2 — CID 71095541
(2R)-2-[[(6-methoxy-1,3-benzothiazol-2-yl)-methylsulfanylmethylidene]amino]propanoic acid (PubChem CID 71095541) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2R)-2-[[(6-methoxy-1,3-benzothiazol-2-yl)-methylsulfanylmethylidene]amino]propanoic acid.
| Compound Name | (2R)-2-[[(6-methoxy-1,3-benzothiazol-2-yl)-methylsulfanylmethylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 71095541 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | (2R)-2-[[(6-methoxy-1,3-benzothiazol-2-yl)-methylsulfanylmethylidene]amino]propanoic acid |
| SMILES | COc1ccc2nc(/C(=N/[C@H](C)C(=O)O)SC)sc2c1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-7(13(16)17)14-11(19-3)12-15-9-5-4-8(18-2)6-10(9)20-12/h4-7H,1-3H3,(H,16,17)/b14-11-/t7-/m1/s1 |
| InChIKey | GESOMKXXFSLLNH-ODFQPRPBSA-N |
| XLogP | 2.89 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|