C11H13N3O2S3 — CID 22299752
3-(6-methoxy-1,3-benzothiazol-2-yl)-1,1-bis(methylsulfanyl)urea (PubChem CID 22299752) has the molecular formula C11H13N3O2S3 and a molecular weight of 315.45 g/mol. Its IUPAC name is 3-(6-methoxy-1,3-benzothiazol-2-yl)-1,1-bis(methylsulfanyl)urea.
| Compound Name | 3-(6-methoxy-1,3-benzothiazol-2-yl)-1,1-bis(methylsulfanyl)urea |
|---|---|
| PubChem CID | 22299752 |
| Molecular Formula | C11H13N3O2S3 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 3-(6-methoxy-1,3-benzothiazol-2-yl)-1,1-bis(methylsulfanyl)urea |
| SMILES | COc1ccc2nc(NC(=O)N(SC)SC)sc2c1 |
| InChI | InChI=1S/C11H13N3O2S3/c1-16-7-4-5-8-9(6-7)19-10(12-8)13-11(15)14(17-2)18-3/h4-6H,1-3H3,(H,12,13,15) |
| InChIKey | KKAFQNOQCIZHCN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|