C15H12N2O3S2 — CID 18126513
5-acetyl-N-(6-methoxy-1,3-benzothiazol-2-yl)thiophene-2-carboxamide (PubChem CID 18126513) has the molecular formula C15H12N2O3S2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 5-acetyl-N-(6-methoxy-1,3-benzothiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-(6-methoxy-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18126513 |
| Molecular Formula | C15H12N2O3S2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 5-acetyl-N-(6-methoxy-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
| SMILES | COc1ccc2nc(NC(=O)c3ccc(C(C)=O)s3)sc2c1 |
| InChI | InChI=1S/C15H12N2O3S2/c1-8(18)11-5-6-12(21-11)14(19)17-15-16-10-4-3-9(20-2)7-13(10)22-15/h3-7H,1-2H3,(H,16,17,19) |
| InChIKey | SEOPYRLBYQYMQM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |