ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate

C13H13NO4S — CID 22059303

IUPACethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate
SMILESCCOC(=O)CC(=O)c1nc2ccc(OC)cc2s1
InChIInChI=1S/C13H13NO4S/c1-3-18-12(16)7-10(15)13-14-9-5-4-8(17-2)6-11(9)19-13/h4-6H,3,7H2,1-2H3
InChIKeyIKBANUAXYZZHNQ-UHFFFAOYSA-N
MW279.32 g/mol
LogP2.44
Rot. Bonds5

About ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate

ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate (PubChem CID 22059303) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate.

Molecular Properties

Compound Nameethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate
PubChem CID22059303
Molecular FormulaC13H13NO4S
Molecular Weight279.32 g/mol
Exact Mass279.06
IUPAC Nameethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate
SMILESCCOC(=O)CC(=O)c1nc2ccc(OC)cc2s1
InChIInChI=1S/C13H13NO4S/c1-3-18-12(16)7-10(15)13-14-9-5-4-8(17-2)6-11(9)19-13/h4-6H,3,7H2,1-2H3
InChIKeyIKBANUAXYZZHNQ-UHFFFAOYSA-N
XLogP2.44
TPSA65.49 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.32
LogP ≤ 52.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate?
The IUPAC name of ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate (CID 22059303) is ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate.
What is the SMILES notation for ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate?
The canonical SMILES for ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate is CCOC(=O)CC(=O)c1nc2ccc(OC)cc2s1.
What is the InChIKey of ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate?
The InChIKey is IKBANUAXYZZHNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4S/c1-3-18-12(16)7-10(15)13-14-9-5-4-8(17-2)6-11(9)19-13/h4-6H,3,7H2,1-2H3.
What are the key properties of ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate?
ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate has a molecular weight of 279.32 g/mol, XLogP of 2.44, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate is sourced from PubChem (CID 22059303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).