C13H13NO4S — CID 22059303
ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate (PubChem CID 22059303) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate.
| Compound Name | ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 22059303 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C13H13NO4S/c1-3-18-12(16)7-10(15)13-14-9-5-4-8(17-2)6-11(9)19-13/h4-6H,3,7H2,1-2H3 |
| InChIKey | IKBANUAXYZZHNQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|