C13H13NO3S — CID 83766867
ethyl (E)-3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 83766867) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is ethyl (E)-3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 83766867 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | ethyl (E)-3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C13H13NO3S/c1-3-17-13(15)7-6-12-14-10-5-4-9(16-2)8-11(10)18-12/h4-8H,3H2,1-2H3/b7-6+ |
| InChIKey | ZOIGLTKEUWGXNZ-VOTSOKGWSA-N |
| XLogP | 2.88 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|