C10H8BrNOS — CID 154691622
2-[(E)-2-bromoethenyl]-6-methoxy-1,3-benzothiazole (PubChem CID 154691622) has the molecular formula C10H8BrNOS and a molecular weight of 270.15 g/mol. Its IUPAC name is 2-[(E)-2-bromoethenyl]-6-methoxy-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-bromoethenyl]-6-methoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 154691622 |
| Molecular Formula | C10H8BrNOS |
| Molecular Weight | 270.15 g/mol |
| Exact Mass | 268.95 |
| IUPAC Name | 2-[(E)-2-bromoethenyl]-6-methoxy-1,3-benzothiazole |
| SMILES | COc1ccc2nc(/C=C/Br)sc2c1 |
| InChI | InChI=1S/C10H8BrNOS/c1-13-7-2-3-8-9(6-7)14-10(12-8)4-5-11/h2-6H,1H3/b5-4+ |
| InChIKey | VRVYJZHYHQTQED-SNAWJCMRSA-N |
| XLogP | 3.67 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |