C13H15NO3S — CID 146663754
ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)propanoate (PubChem CID 146663754) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)propanoate.
| Compound Name | ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 146663754 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | ethyl 3-(6-methoxy-1,3-benzothiazol-2-yl)propanoate |
| SMILES | CCOC(=O)CCc1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C13H15NO3S/c1-3-17-13(15)7-6-12-14-10-5-4-9(16-2)8-11(10)18-12/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | IIZCVZJFQDTQHE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |