C11H14N2O2S — CID 82621598
2-amino-1-(5-methoxy-1,3-benzothiazol-2-yl)propan-1-ol (PubChem CID 82621598) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-amino-1-(5-methoxy-1,3-benzothiazol-2-yl)propan-1-ol.
| Compound Name | 2-amino-1-(5-methoxy-1,3-benzothiazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 82621598 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-amino-1-(5-methoxy-1,3-benzothiazol-2-yl)propan-1-ol |
| SMILES | COc1ccc2sc(C(O)C(C)N)nc2c1 |
| InChI | InChI=1S/C11H14N2O2S/c1-6(12)10(14)11-13-8-5-7(15-2)3-4-9(8)16-11/h3-6,10,14H,12H2,1-2H3 |
| InChIKey | MCIVUHUMDLRCJB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |