C16H15NO3S — CID 66584990
(6-methoxy-1,3-benzothiazol-2-yl)-(3-methoxyphenyl)methanol (PubChem CID 66584990) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is (6-methoxy-1,3-benzothiazol-2-yl)-(3-methoxyphenyl)methanol.
| Compound Name | (6-methoxy-1,3-benzothiazol-2-yl)-(3-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 66584990 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (6-methoxy-1,3-benzothiazol-2-yl)-(3-methoxyphenyl)methanol |
| SMILES | COc1cccc(C(O)c2nc3ccc(OC)cc3s2)c1 |
| InChI | InChI=1S/C16H15NO3S/c1-19-11-5-3-4-10(8-11)15(18)16-17-13-7-6-12(20-2)9-14(13)21-16/h3-9,15,18H,1-2H3 |
| InChIKey | XSCDQSNUVJCAJJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |