C15H11ClN2OS — CID 43156362
N-(1,3-benzothiazol-2-yl)-3-(chloromethyl)benzamide (PubChem CID 43156362) has the molecular formula C15H11ClN2OS and a molecular weight of 302.79 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3-(chloromethyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3-(chloromethyl)benzamide |
|---|---|
| PubChem CID | 43156362 |
| Molecular Formula | C15H11ClN2OS |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3-(chloromethyl)benzamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1cccc(CCl)c1 |
| InChI | InChI=1S/C15H11ClN2OS/c16-9-10-4-3-5-11(8-10)14(19)18-15-17-12-6-1-2-7-13(12)20-15/h1-8H,9H2,(H,17,18,19) |
| InChIKey | SYNTXCQUQILDBR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|