C16H10N4OS — CID 2983645
N-(1,3-benzothiazol-2-yl)quinoxaline-6-carboxamide (PubChem CID 2983645) has the molecular formula C16H10N4OS and a molecular weight of 306.35 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)quinoxaline-6-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 2983645 |
| Molecular Formula | C16H10N4OS |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)quinoxaline-6-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C16H10N4OS/c21-15(10-5-6-11-13(9-10)18-8-7-17-11)20-16-19-12-3-1-2-4-14(12)22-16/h1-9H,(H,19,20,21) |
| InChIKey | QYHISYIWUURHJN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |