C16H16N2O2S2 — CID 82549061
N-benzyl-6-ethylsulfonyl-1,3-benzothiazol-2-amine (PubChem CID 82549061) has the molecular formula C16H16N2O2S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N-benzyl-6-ethylsulfonyl-1,3-benzothiazol-2-amine.
| Compound Name | N-benzyl-6-ethylsulfonyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549061 |
| Molecular Formula | C16H16N2O2S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-benzyl-6-ethylsulfonyl-1,3-benzothiazol-2-amine |
| SMILES | CCS(=O)(=O)c1ccc2nc(NCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C16H16N2O2S2/c1-2-22(19,20)13-8-9-14-15(10-13)21-16(18-14)17-11-12-6-4-3-5-7-12/h3-10H,2,11H2,1H3,(H,17,18) |
| InChIKey | YZSVMTXVQRVJLD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |